C19H14Cl2FN3O2 — CID 123749757
4-[[5-(1-chloroethyl)-2-(5-chloro-2-fluorophenyl)-4-pyridinyl]amino]pyridine-3-carboxylic acid (PubChem CID 123749757) has the molecular formula C19H14Cl2FN3O2 and a molecular weight of 406.24 g/mol. Its IUPAC name is 4-[[5-(1-chloroethyl)-2-(5-chloro-2-fluorophenyl)-4-pyridinyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 4-[[5-(1-chloroethyl)-2-(5-chloro-2-fluorophenyl)-4-pyridinyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 123749757 |
| Molecular Formula | C19H14Cl2FN3O2 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-[[5-(1-chloroethyl)-2-(5-chloro-2-fluorophenyl)-4-pyridinyl]amino]pyridine-3-carboxylic acid |
| SMILES | CC(Cl)c1cnc(-c2cc(Cl)ccc2F)cc1Nc1ccncc1C(=O)O |
| InChI | InChI=1S/C19H14Cl2FN3O2/c1-10(20)13-9-24-17(12-6-11(21)2-3-15(12)22)7-18(13)25-16-4-5-23-8-14(16)19(26)27/h2-10H,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | NVYNVTCAVJHACT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|