C2H8O3Si3 — CID 123749917
2-ethenyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 123749917) has the molecular formula C2H8O3Si3 and a molecular weight of 164.34 g/mol. Its IUPAC name is 2-ethenyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-ethenyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 123749917 |
| Molecular Formula | C2H8O3Si3 |
| Molecular Weight | 164.34 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | 2-ethenyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C=C[SiH]1O[SiH2]O[SiH2]O1 |
| InChI | InChI=1S/C2H8O3Si3/c1-2-8-4-6-3-7-5-8/h2,8H,1,6-7H2 |
| InChIKey | OWMXUQBMZMDCJB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.34 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|