C22H25F3N6O — CID 123750124
11-(isocyanomethyl)-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one (PubChem CID 123750124) has the molecular formula C22H25F3N6O and a molecular weight of 446.48 g/mol. Its IUPAC name is 11-(isocyanomethyl)-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one.
| Compound Name | 11-(isocyanomethyl)-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 123750124 |
| Molecular Formula | C22H25F3N6O |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 11-(isocyanomethyl)-13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
| SMILES | [C-]#[N+]CN1CN(C2CCC(CNC3(C(F)(F)F)CC3)CC2)c2c(cnc3[nH]ccc23)C1=O |
| InChI | InChI=1S/C22H25F3N6O/c1-26-12-30-13-31(18-16-6-9-27-19(16)28-11-17(18)20(30)32)15-4-2-14(3-5-15)10-29-21(7-8-21)22(23,24)25/h6,9,11,14-15,29H,2-5,7-8,10,12-13H2,(H,27,28) |
| InChIKey | KWCKMXJZBJXTAY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|