C12H23N — CID 123750345
3-ethyl-1,2,2,4,5,5-hexamethylpyrrole (PubChem CID 123750345) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 3-ethyl-1,2,2,4,5,5-hexamethylpyrrole.
| Compound Name | 3-ethyl-1,2,2,4,5,5-hexamethylpyrrole |
|---|---|
| PubChem CID | 123750345 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 3-ethyl-1,2,2,4,5,5-hexamethylpyrrole |
| SMILES | CCC1=C(C)C(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C12H23N/c1-8-10-9(2)11(3,4)13(7)12(10,5)6/h8H2,1-7H3 |
| InChIKey | FVEMDXBEORCORP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|