About 6-fluoro-N-propyl-1,3-benzoxazol-2-amine
6-fluoro-N-propyl-1,3-benzoxazol-2-amine (PubChem CID 123750447) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is 6-fluoro-N-propyl-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 6-fluoro-N-propyl-1,3-benzoxazol-2-amine |
| PubChem CID | 123750447 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6-fluoro-N-propyl-1,3-benzoxazol-2-amine |
| SMILES | CCCNc1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C10H11FN2O/c1-2-5-12-10-13-8-4-3-7(11)6-9(8)14-10/h3-4,6H,2,5H2,1H3,(H,12,13) |
| InChIKey | KDYOUGJEBNJSMD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-N-propyl-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-propyl-1,3-benzoxazol-2-amine?
The IUPAC name of 6-fluoro-N-propyl-1,3-benzoxazol-2-amine (CID 123750447) is 6-fluoro-N-propyl-1,3-benzoxazol-2-amine.
What is the SMILES notation for 6-fluoro-N-propyl-1,3-benzoxazol-2-amine?
The canonical SMILES for 6-fluoro-N-propyl-1,3-benzoxazol-2-amine is CCCNc1nc2ccc(F)cc2o1.
What is the InChIKey of 6-fluoro-N-propyl-1,3-benzoxazol-2-amine?
The InChIKey is KDYOUGJEBNJSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O/c1-2-5-12-10-13-8-4-3-7(11)6-9(8)14-10/h3-4,6H,2,5H2,1H3,(H,12,13).
What are the key properties of 6-fluoro-N-propyl-1,3-benzoxazol-2-amine?
6-fluoro-N-propyl-1,3-benzoxazol-2-amine has a molecular weight of 194.21 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-propyl-1,3-benzoxazol-2-amine is sourced from PubChem (CID 123750447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).