C23H16BrCl2F3N2O3 — CID 123750710
4-[2-(6-bromo-2-pyridinyl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-1,2-oxazolidin-3-yl]-2-methylbenzoic acid (PubChem CID 123750710) has the molecular formula C23H16BrCl2F3N2O3 and a molecular weight of 576.20 g/mol. Its IUPAC name is 4-[2-(6-bromo-2-pyridinyl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-1,2-oxazolidin-3-yl]-2-methylbenzoic acid.
| Compound Name | 4-[2-(6-bromo-2-pyridinyl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-1,2-oxazolidin-3-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 123750710 |
| Molecular Formula | C23H16BrCl2F3N2O3 |
| Molecular Weight | 576.20 g/mol |
| Exact Mass | 573.97 |
| IUPAC Name | 4-[2-(6-bromo-2-pyridinyl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-1,2-oxazolidin-3-yl]-2-methylbenzoic acid |
| SMILES | Cc1cc(C2CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2c2cccc(Br)n2)ccc1C(=O)O |
| InChI | InChI=1S/C23H16BrCl2F3N2O3/c1-12-7-13(5-6-17(12)21(32)33)18-11-22(23(27,28)29,14-8-15(25)10-16(26)9-14)34-31(18)20-4-2-3-19(24)30-20/h2-10,18H,11H2,1H3,(H,32,33) |
| InChIKey | XZNYZUQWAFLHAL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.20 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|