C33H26N2O8 — CID 123750890
[2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-(pyridine-3-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] pyridine-3-carboxylate (PubChem CID 123750890) has the molecular formula C33H26N2O8 and a molecular weight of 578.58 g/mol. Its IUPAC name is [2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-(pyridine-3-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-(pyridine-3-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 123750890 |
| Molecular Formula | C33H26N2O8 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | [2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-(pyridine-3-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] pyridine-3-carboxylate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)c3cccnc3)c(OC)c2)ccc1OC(=O)c1cccnc1 |
| InChI | InChI=1S/C33H26N2O8/c1-40-30-17-22(9-13-28(30)42-32(38)24-5-3-15-34-20-24)7-11-26(36)19-27(37)12-8-23-10-14-29(31(18-23)41-2)43-33(39)25-6-4-16-35-21-25/h3-18,20-21H,19H2,1-2H3/b11-7+,12-8+ |
| InChIKey | COODRNJLGVTDGE-MKICQXMISA-N |
| XLogP | 5.19 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|