About 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid
2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid (PubChem CID 123750938) has the molecular formula C9H13FO3
and a molecular weight of 188.20 g/mol. Its IUPAC name is 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid.
Molecular Properties
| Compound Name | 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid |
| PubChem CID | 123750938 |
| Molecular Formula | C9H13FO3 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid |
| SMILES | C=C(F)C=C(CC)COCC(=O)O |
| InChI | InChI=1S/C9H13FO3/c1-3-8(4-7(2)10)5-13-6-9(11)12/h4H,2-3,5-6H2,1H3,(H,11,12) |
| InChIKey | SUKVRSFSNCRDED-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid?
The IUPAC name of 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid (CID 123750938) is 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid.
What is the SMILES notation for 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid?
The canonical SMILES for 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid is C=C(F)C=C(CC)COCC(=O)O.
What is the InChIKey of 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid?
The InChIKey is SUKVRSFSNCRDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO3/c1-3-8(4-7(2)10)5-13-6-9(11)12/h4H,2-3,5-6H2,1H3,(H,11,12).
What are the key properties of 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid?
2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid has a molecular weight of 188.20 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-4-fluoropenta-2,4-dienoxy)acetic acid is sourced from PubChem (CID 123750938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).