About 3-ethyl-6-fluoro-3,4-dihydropyridine
3-ethyl-6-fluoro-3,4-dihydropyridine (PubChem CID 123750960) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is 3-ethyl-6-fluoro-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 3-ethyl-6-fluoro-3,4-dihydropyridine |
| PubChem CID | 123750960 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 3-ethyl-6-fluoro-3,4-dihydropyridine |
| SMILES | CCC1C=NC(F)=CC1 |
| InChI | InChI=1S/C7H10FN/c1-2-6-3-4-7(8)9-5-6/h4-6H,2-3H2,1H3 |
| InChIKey | YHOGMDLFCZFQGA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6-fluoro-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-fluoro-3,4-dihydropyridine?
The IUPAC name of 3-ethyl-6-fluoro-3,4-dihydropyridine (CID 123750960) is 3-ethyl-6-fluoro-3,4-dihydropyridine.
What is the SMILES notation for 3-ethyl-6-fluoro-3,4-dihydropyridine?
The canonical SMILES for 3-ethyl-6-fluoro-3,4-dihydropyridine is CCC1C=NC(F)=CC1.
What is the InChIKey of 3-ethyl-6-fluoro-3,4-dihydropyridine?
The InChIKey is YHOGMDLFCZFQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN/c1-2-6-3-4-7(8)9-5-6/h4-6H,2-3H2,1H3.
What are the key properties of 3-ethyl-6-fluoro-3,4-dihydropyridine?
3-ethyl-6-fluoro-3,4-dihydropyridine has a molecular weight of 127.16 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-fluoro-3,4-dihydropyridine is sourced from PubChem (CID 123750960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).