C18H18N6O3S — CID 123750989
N'-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]furan-2-carboximidamide (PubChem CID 123750989) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is N'-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]furan-2-carboximidamide.
| Compound Name | N'-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]furan-2-carboximidamide |
|---|---|
| PubChem CID | 123750989 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N'-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]furan-2-carboximidamide |
| SMILES | N/C(=N\C1CCN(c2nccc(C=C3SC(=O)NC3=O)n2)CC1)c1ccco1 |
| InChI | InChI=1S/C18H18N6O3S/c19-15(13-2-1-9-27-13)21-11-4-7-24(8-5-11)17-20-6-3-12(22-17)10-14-16(25)23-18(26)28-14/h1-3,6,9-11H,4-5,7-8H2,(H2,19,21)(H,23,25,26) |
| InChIKey | ISADVWYTAMACMI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|