C21H26N6O — CID 1237510
2-[[4-(diethylamino)-6-(2,5-dimethylanilino)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 1237510) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-6-(2,5-dimethylanilino)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 2-[[4-(diethylamino)-6-(2,5-dimethylanilino)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 1237510 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[[4-(diethylamino)-6-(2,5-dimethylanilino)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | CCN(CC)c1nc(Nc2cc(C)ccc2C)nc(Nc2ccccc2O)n1 |
| InChI | InChI=1S/C21H26N6O/c1-5-27(6-2)21-25-19(22-16-9-7-8-10-18(16)28)24-20(26-21)23-17-13-14(3)11-12-15(17)4/h7-13,28H,5-6H2,1-4H3,(H2,22,23,24,25,26) |
| InChIKey | YVHHPQKCJBJYSC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|