C34H41Cl2N5O3 — CID 123751004
[5-[4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butylamino]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone (PubChem CID 123751004) has the molecular formula C34H41Cl2N5O3 and a molecular weight of 638.64 g/mol. Its IUPAC name is [5-[4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butylamino]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone.
| Compound Name | [5-[4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butylamino]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 123751004 |
| Molecular Formula | C34H41Cl2N5O3 |
| Molecular Weight | 638.64 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | [5-[4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butylamino]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2Cc3ccc(NCCCCc4nc5cc(N(CCCl)CCCl)ccc5n4C)cc3C2)c(O)cc1O |
| InChI | InChI=1S/C34H41Cl2N5O3/c1-22(2)27-18-28(32(43)19-31(27)42)34(44)41-20-23-7-8-25(16-24(23)21-41)37-13-5-4-6-33-38-29-17-26(9-10-30(29)39(33)3)40(14-11-35)15-12-36/h7-10,16-19,22,37,42-43H,4-6,11-15,20-21H2,1-3H3 |
| InChIKey | VPCVYWYZBCBWGL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|