About 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine
1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine (PubChem CID 123751147) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine |
| PubChem CID | 123751147 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CC(OC)=C(OC)CC1 |
| InChI | InChI=1S/C10H15NO2/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h6,11H,4-5H2,1-3H3/b11-7+ |
| InChIKey | HLZHQEAFMSPWGY-YRNVUSSQSA-N |
| XLogP | 2.25 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine?
The IUPAC name of 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine (CID 123751147) is 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine.
What is the SMILES notation for 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine?
The canonical SMILES for 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine is [H]/N=C(\C)C1=CC(OC)=C(OC)CC1.
What is the InChIKey of 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine?
The InChIKey is HLZHQEAFMSPWGY-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H15NO2/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h6,11H,4-5H2,1-3H3/b11-7+.
What are the key properties of 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine?
1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine has a molecular weight of 181.23 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanimine is sourced from PubChem (CID 123751147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).