C27H35F3N4O5Si — CID 123751348
methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate (PubChem CID 123751348) has the molecular formula C27H35F3N4O5Si and a molecular weight of 580.68 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123751348 |
| Molecular Formula | C27H35F3N4O5Si |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(OCC(F)(F)F)n(COCC[Si](C)(C)C)n3)cc2)cn1 |
| InChI | InChI=1S/C27H35F3N4O5Si/c1-26(2,24(35)36-3)16-38-22-12-11-21(15-31-22)19-7-9-20(10-8-19)23-32-25(39-17-27(28,29)30)34(33-23)18-37-13-14-40(4,5)6/h7-12,15H,13-14,16-18H2,1-6H3 |
| InChIKey | DAZCQZBIFVCDOI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|