C13H11NO — CID 123751675
3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole (PubChem CID 123751675) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 123751675 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole |
| SMILES | C1=C(c2cccc3ccccc23)NOC1 |
| InChI | InChI=1S/C13H11NO/c1-2-6-11-10(4-1)5-3-7-12(11)13-8-9-15-14-13/h1-8,14H,9H2 |
| InChIKey | DZZNCFJQULRYKO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |