About 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole
5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole (PubChem CID 123752238) has the molecular formula C5H8F2N2
and a molecular weight of 134.13 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 123752238 |
| Molecular Formula | C5H8F2N2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole |
| SMILES | FC(F)CC1CN=CN1 |
| InChI | InChI=1S/C5H8F2N2/c6-5(7)1-4-2-8-3-9-4/h3-5H,1-2H2,(H,8,9) |
| InChIKey | LSFBUHVKAWFGGU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole (CID 123752238) is 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole is FC(F)CC1CN=CN1.
What is the InChIKey of 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is LSFBUHVKAWFGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2N2/c6-5(7)1-4-2-8-3-9-4/h3-5H,1-2H2,(H,8,9).
What are the key properties of 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole?
5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 134.13 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 123752238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).