C28H40F3N5O3S — CID 123753402
5-[(3-methoxyoxan-4-yl)amino]-N-(2-methylpropyl)-3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbothioamide (PubChem CID 123753402) has the molecular formula C28H40F3N5O3S and a molecular weight of 583.72 g/mol. Its IUPAC name is 5-[(3-methoxyoxan-4-yl)amino]-N-(2-methylpropyl)-3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbothioamide.
| Compound Name | 5-[(3-methoxyoxan-4-yl)amino]-N-(2-methylpropyl)-3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbothioamide |
|---|---|
| PubChem CID | 123753402 |
| Molecular Formula | C28H40F3N5O3S |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 5-[(3-methoxyoxan-4-yl)amino]-N-(2-methylpropyl)-3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbothioamide |
| SMILES | COC1COCCC1NC1CC2CN(C(=S)NCC(C)C)CC2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C28H40F3N5O3S/c1-17(2)11-33-26(40)36-14-20-9-21(34-23-5-7-39-15-24(23)38-3)10-27(20,16-36)25(37)35-6-4-22-18(13-35)8-19(12-32-22)28(29,30)31/h8,12,17,20-21,23-24,34H,4-7,9-11,13-16H2,1-3H3,(H,33,40) |
| InChIKey | OKAOLALRDXDZQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|