About N-but-1-enyl-N,3-dimethylhexan-1-amine
N-but-1-enyl-N,3-dimethylhexan-1-amine (PubChem CID 123754105) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is N-but-1-enyl-N,3-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | N-but-1-enyl-N,3-dimethylhexan-1-amine |
| PubChem CID | 123754105 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N-but-1-enyl-N,3-dimethylhexan-1-amine |
| SMILES | CCC=CN(C)CCC(C)CCC |
| InChI | InChI=1S/C12H25N/c1-5-7-10-13(4)11-9-12(3)8-6-2/h7,10,12H,5-6,8-9,11H2,1-4H3 |
| InChIKey | WLKFBBKOESSVEP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-but-1-enyl-N,3-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-enyl-N,3-dimethylhexan-1-amine?
The IUPAC name of N-but-1-enyl-N,3-dimethylhexan-1-amine (CID 123754105) is N-but-1-enyl-N,3-dimethylhexan-1-amine.
What is the SMILES notation for N-but-1-enyl-N,3-dimethylhexan-1-amine?
The canonical SMILES for N-but-1-enyl-N,3-dimethylhexan-1-amine is CCC=CN(C)CCC(C)CCC.
What is the InChIKey of N-but-1-enyl-N,3-dimethylhexan-1-amine?
The InChIKey is WLKFBBKOESSVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-5-7-10-13(4)11-9-12(3)8-6-2/h7,10,12H,5-6,8-9,11H2,1-4H3.
What are the key properties of N-but-1-enyl-N,3-dimethylhexan-1-amine?
N-but-1-enyl-N,3-dimethylhexan-1-amine has a molecular weight of 183.34 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-enyl-N,3-dimethylhexan-1-amine is sourced from PubChem (CID 123754105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).