About N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine
N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine (PubChem CID 123754500) has the molecular formula C26H49N
and a molecular weight of 375.69 g/mol. Its IUPAC name is N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine.
Molecular Properties
| Compound Name | N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine |
| PubChem CID | 123754500 |
| Molecular Formula | C26H49N |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 375.39 |
| IUPAC Name | N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine |
| SMILES | CCCCCC(CCCC(/N=C/C1CC1CC)C(C)CC(C)C)=C(C)CC |
| InChI | InChI=1S/C26H49N/c1-8-11-12-14-24(21(6)9-2)15-13-16-26(22(7)17-20(4)5)27-19-25-18-23(25)10-3/h19-20,22-23,25-26H,8-18H2,1-7H3/b24-21?,27-19+ |
| InChIKey | NXFZTCLMBFMSFK-YUVKBJJOSA-N |
| XLogP | 8.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine?
The IUPAC name of N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine (CID 123754500) is N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine.
What is the SMILES notation for N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine?
The canonical SMILES for N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine is CCCCCC(CCCC(/N=C/C1CC1CC)C(C)CC(C)C)=C(C)CC.
What is the InChIKey of N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine?
The InChIKey is NXFZTCLMBFMSFK-YUVKBJJOSA-N. The full InChI is InChI=1S/C26H49N/c1-8-11-12-14-24(21(6)9-2)15-13-16-26(22(7)17-20(4)5)27-19-25-18-23(25)10-3/h19-20,22-23,25-26H,8-18H2,1-7H3/b24-21?,27-19+.
What are the key properties of N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine?
N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine has a molecular weight of 375.69 g/mol, XLogP of 8.63, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-butan-2-ylidene-2,4-dimethyltetradecan-5-yl)-1-(2-ethylcyclopropyl)methanimine is sourced from PubChem (CID 123754500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).