C48H41FN2 — CID 123755216
4-[3-[4-[(14-tert-butyl-4-fluoro-8-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)methyl]phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 123755216) has the molecular formula C48H41FN2 and a molecular weight of 664.87 g/mol. Its IUPAC name is 4-[3-[4-[(14-tert-butyl-4-fluoro-8-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)methyl]phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[3-[4-[(14-tert-butyl-4-fluoro-8-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)methyl]phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 123755216 |
| Molecular Formula | C48H41FN2 |
| Molecular Weight | 664.87 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | 4-[3-[4-[(14-tert-butyl-4-fluoro-8-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)methyl]phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(F)ccc1C(Cc1ccc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc1)CC2 |
| InChI | InChI=1S/C48H41FN2/c1-48(2,3)40-24-23-34-21-22-38(42-26-25-41(49)30-44(42)43(34)29-40)27-32-17-19-33(20-18-32)37-15-10-16-39(28-37)46-31-45(35-11-6-4-7-12-35)50-47(51-46)36-13-8-5-9-14-36/h4-20,23-26,28-31,38H,21-22,27H2,1-3H3 |
| InChIKey | PUPLFGKDWJTZKZ-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.87 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |