C17H20F6N2 — CID 123755567
4-[(3Z,5Z)-7-imino-3-(trifluoromethyl)octa-1,3,5-trien-4-yl]-N-methyl-3-(trifluoromethyl)cyclohex-2-en-1-amine (PubChem CID 123755567) has the molecular formula C17H20F6N2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-[(3Z,5Z)-7-imino-3-(trifluoromethyl)octa-1,3,5-trien-4-yl]-N-methyl-3-(trifluoromethyl)cyclohex-2-en-1-amine.
| Compound Name | 4-[(3Z,5Z)-7-imino-3-(trifluoromethyl)octa-1,3,5-trien-4-yl]-N-methyl-3-(trifluoromethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 123755567 |
| Molecular Formula | C17H20F6N2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-[(3Z,5Z)-7-imino-3-(trifluoromethyl)octa-1,3,5-trien-4-yl]-N-methyl-3-(trifluoromethyl)cyclohex-2-en-1-amine |
| SMILES | [H]/N=C(C)\C=C/C(=C(\C=C)C(F)(F)F)C1CCC(NC)C=C1C(F)(F)F |
| InChI | InChI=1S/C17H20F6N2/c1-4-14(16(18,19)20)12(7-5-10(2)24)13-8-6-11(25-3)9-15(13)17(21,22)23/h4-5,7,9,11,13,24-25H,1,6,8H2,2-3H3/b7-5-,14-12-,24-10- |
| InChIKey | AGZZFZJHSSYYSK-XOSYGFPDSA-N |
| XLogP | 5.11 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|