C23H25FN6O3S — CID 123755843
2-[10-(benzenesulfonyl)-3-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide (PubChem CID 123755843) has the molecular formula C23H25FN6O3S and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[10-(benzenesulfonyl)-3-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide.
| Compound Name | 2-[10-(benzenesulfonyl)-3-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide |
|---|---|
| PubChem CID | 123755843 |
| Molecular Formula | C23H25FN6O3S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[10-(benzenesulfonyl)-3-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide |
| SMILES | CC[C@@]1(n2c(CC(N)=O)nc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CCNC[C@@H]1F |
| InChI | InChI=1S/C23H25FN6O3S/c1-2-23(9-10-26-14-18(23)24)30-20(12-19(25)31)28-17-13-27-22-16(21(17)30)8-11-29(22)34(32,33)15-6-4-3-5-7-15/h3-8,11,13,18,26H,2,9-10,12,14H2,1H3,(H2,25,31)/t18-,23+/m0/s1 |
| InChIKey | ONAGXEOLZVKKSS-FDDCHVKYSA-N |
| XLogP | 2.09 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |