C36H54FN4O7P — CID 123755974
N-[2-[[1-[4-fluoro-3-hydroxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]ethoxy-methoxyphosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123755974) has the molecular formula C36H54FN4O7P and a molecular weight of 704.82 g/mol. Its IUPAC name is N-[2-[[1-[4-fluoro-3-hydroxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]ethoxy-methoxyphosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-[2-[[1-[4-fluoro-3-hydroxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]ethoxy-methoxyphosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123755974 |
| Molecular Formula | C36H54FN4O7P |
| Molecular Weight | 704.82 g/mol |
| Exact Mass | 704.37 |
| IUPAC Name | N-[2-[[1-[4-fluoro-3-hydroxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]ethoxy-methoxyphosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNP(=O)(OC)OC(C)C1OC(n2ccc(C)nc2=O)C(F)C1O |
| InChI | InChI=1S/C36H54FN4O7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-31(42)38-26-27-39-49(45,46-4)48-30(3)34-33(43)32(37)35(47-34)41-28-25-29(2)40-36(41)44/h6-7,9-10,12-13,15-16,18-19,21-22,25,28,30,32-35,43H,5,8,11,14,17,20,23-24,26-27H2,1-4H3,(H,38,42)(H,39,45) |
| InChIKey | JPIPEMMWNGMVKB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.82 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|