C21H16F3NO — CID 123756245
4-(3,4-difluorophenyl)-6-fluoro-9-methyl-12-azatricyclo[8.4.1.03,8]pentadeca-1(15),3,5,7,9-pentaen-11-one (PubChem CID 123756245) has the molecular formula C21H16F3NO and a molecular weight of 355.36 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-6-fluoro-9-methyl-12-azatricyclo[8.4.1.03,8]pentadeca-1(15),3,5,7,9-pentaen-11-one.
| Compound Name | 4-(3,4-difluorophenyl)-6-fluoro-9-methyl-12-azatricyclo[8.4.1.03,8]pentadeca-1(15),3,5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 123756245 |
| Molecular Formula | C21H16F3NO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-(3,4-difluorophenyl)-6-fluoro-9-methyl-12-azatricyclo[8.4.1.03,8]pentadeca-1(15),3,5,7,9-pentaen-11-one |
| SMILES | CC1=C2C=C(CCNC2=O)Cc2c1cc(F)cc2-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H16F3NO/c1-11-15-9-14(22)10-17(13-2-3-19(23)20(24)8-13)18(15)7-12-4-5-25-21(26)16(11)6-12/h2-3,6,8-10H,4-5,7H2,1H3,(H,25,26) |
| InChIKey | RWAWCXRCAZJYFR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |