C23H28FNO2 — CID 123756370
2-butan-2-yl-5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)hepta-2,4,6-trienamide (PubChem CID 123756370) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is 2-butan-2-yl-5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)hepta-2,4,6-trienamide.
| Compound Name | 2-butan-2-yl-5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 123756370 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-butan-2-yl-5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)hepta-2,4,6-trienamide |
| SMILES | C=CC(C#Cc1cccc(F)c1)=CC=C(C(=O)NC(C)(C)CO)C(C)CC |
| InChI | InChI=1S/C23H28FNO2/c1-6-17(3)21(22(27)25-23(4,5)16-26)14-13-18(7-2)11-12-19-9-8-10-20(24)15-19/h7-10,13-15,17,26H,2,6,16H2,1,3-5H3,(H,25,27) |
| InChIKey | QVZPAAWZDIASQI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|