About 2-phenyl-1,3-thiazepine
2-phenyl-1,3-thiazepine (PubChem CID 123756534) has the molecular formula C11H9NS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-phenyl-1,3-thiazepine.
Molecular Properties
| Compound Name | 2-phenyl-1,3-thiazepine |
| PubChem CID | 123756534 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-phenyl-1,3-thiazepine |
| SMILES | C1=CN=C(c2ccccc2)SC=C1 |
| InChI | InChI=1S/C11H9NS/c1-2-6-10(7-3-1)11-12-8-4-5-9-13-11/h1-9H |
| InChIKey | NWXCJAVYTXVAJJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1,3-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-thiazepine?
The IUPAC name of 2-phenyl-1,3-thiazepine (CID 123756534) is 2-phenyl-1,3-thiazepine.
What is the SMILES notation for 2-phenyl-1,3-thiazepine?
The canonical SMILES for 2-phenyl-1,3-thiazepine is C1=CN=C(c2ccccc2)SC=C1.
What is the InChIKey of 2-phenyl-1,3-thiazepine?
The InChIKey is NWXCJAVYTXVAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS/c1-2-6-10(7-3-1)11-12-8-4-5-9-13-11/h1-9H.
What are the key properties of 2-phenyl-1,3-thiazepine?
2-phenyl-1,3-thiazepine has a molecular weight of 187.27 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-thiazepine is sourced from PubChem (CID 123756534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).