C66H55BN2O2 — CID 123756730
2-[3-(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole (PubChem CID 123756730) has the molecular formula C66H55BN2O2 and a molecular weight of 918.99 g/mol. Its IUPAC name is 2-[3-(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole.
| Compound Name | 2-[3-(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 123756730 |
| Molecular Formula | C66H55BN2O2 |
| Molecular Weight | 918.99 g/mol |
| Exact Mass | 918.44 |
| IUPAC Name | 2-[3-(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc(-c5cc(B6OC(C)(C)C(C)(C)O6)cc(-c6ccc7c(c6)c6cc8c(cc6n7-c6ccccc6)C(C)(C)c6ccccc6-8)c5)ccc4n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C66H55BN2O2/c1-63(2)55-25-17-15-23-47(55)49-36-53-51-34-40(27-29-59(51)68(61(53)38-57(49)63)45-19-11-9-12-20-45)42-31-43(33-44(32-42)67-70-65(5,6)66(7,8)71-67)41-28-30-60-52(35-41)54-37-50-48-24-16-18-26-56(48)64(3,4)58(50)39-62(54)69(60)46-21-13-10-14-22-46/h9-39H,1-8H3 |
| InChIKey | XRBVLVAIKKADQO-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.99 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|