About N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione
N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione (PubChem CID 123756990) has the molecular formula C14H26N2O4S
and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione |
| PubChem CID | 123756990 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione |
| SMILES | CCCC(=O)NC(C)OCC.CSC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C8H17NO2.C6H9NO2S/c1-4-6-8(10)9-7(3)11-5-2;1-7-5(8)3-4(10-2)6(7)9/h7H,4-6H2,1-3H3,(H,9,10);4H,3H2,1-2H3 |
| InChIKey | GIFRIGAYMDFQFK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione?
The IUPAC name of N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione (CID 123756990) is N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione.
What is the SMILES notation for N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione?
The canonical SMILES for N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione is CCCC(=O)NC(C)OCC.CSC1CC(=O)N(C)C1=O.
What is the InChIKey of N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione?
The InChIKey is GIFRIGAYMDFQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.C6H9NO2S/c1-4-6-8(10)9-7(3)11-5-2;1-7-5(8)3-4(10-2)6(7)9/h7H,4-6H2,1-3H3,(H,9,10);4H,3H2,1-2H3.
What are the key properties of N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione?
N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione has a molecular weight of 318.44 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethoxyethyl)butanamide;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione is sourced from PubChem (CID 123756990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).