C23H36OS — CID 123757350
1-ethylsulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol (PubChem CID 123757350) has the molecular formula C23H36OS and a molecular weight of 360.61 g/mol. Its IUPAC name is 1-ethylsulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol.
| Compound Name | 1-ethylsulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol |
|---|---|
| PubChem CID | 123757350 |
| Molecular Formula | C23H36OS |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-ethylsulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCC(O)SCC |
| InChI | InChI=1S/C23H36OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,23-24H,3-4,7,10,13,16,19,22H2,1-2H3 |
| InChIKey | WSEKSVNNXCTXTH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|