C22H19N3 — CID 123757495
2-(4-methylphenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 123757495) has the molecular formula C22H19N3 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(4-methylphenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 123757495 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-(4-methylphenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | Cc1ccc(C2=NC(c3ccccc3)N=C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C22H19N3/c1-16-12-14-19(15-13-16)22-24-20(17-8-4-2-5-9-17)23-21(25-22)18-10-6-3-7-11-18/h2-15,20H,1H3,(H,23,24,25) |
| InChIKey | RVZDRNLAYXJBJE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |