About 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine
3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine (PubChem CID 123758096) has the molecular formula C12H18F3N3
and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine.
Molecular Properties
| Compound Name | 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine |
| PubChem CID | 123758096 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine |
| SMILES | CCC/N=C1\CC(CC)C(N)=NC=C1C(F)(F)F |
| InChI | InChI=1S/C12H18F3N3/c1-3-5-17-10-6-8(4-2)11(16)18-7-9(10)12(13,14)15/h7-8H,3-6H2,1-2H3,(H2,16,18)/b17-10+ |
| InChIKey | WTNCEMNQZNCNPE-LICLKQGHSA-N |
| XLogP | 3.07 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine?
The IUPAC name of 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine (CID 123758096) is 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine.
What is the SMILES notation for 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine?
The canonical SMILES for 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine is CCC/N=C1\CC(CC)C(N)=NC=C1C(F)(F)F.
What is the InChIKey of 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine?
The InChIKey is WTNCEMNQZNCNPE-LICLKQGHSA-N. The full InChI is InChI=1S/C12H18F3N3/c1-3-5-17-10-6-8(4-2)11(16)18-7-9(10)12(13,14)15/h7-8H,3-6H2,1-2H3,(H2,16,18)/b17-10+.
What are the key properties of 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine?
3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine has a molecular weight of 261.29 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-propylimino-6-(trifluoromethyl)-3,4-dihydroazepin-2-amine is sourced from PubChem (CID 123758096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).