C27H22F2N2+2 — CID 123758344
9-fluoro-6-[5-fluoro-3-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]-11-methylbenzo[a]quinolizin-5-ium (PubChem CID 123758344) has the molecular formula C27H22F2N2+2 and a molecular weight of 412.48 g/mol. Its IUPAC name is 9-fluoro-6-[5-fluoro-3-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]-11-methylbenzo[a]quinolizin-5-ium.
| Compound Name | 9-fluoro-6-[5-fluoro-3-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]-11-methylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123758344 |
| Molecular Formula | C27H22F2N2+2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 9-fluoro-6-[5-fluoro-3-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]-11-methylbenzo[a]quinolizin-5-ium |
| SMILES | Cc1cc(F)cc(-c2cc3cc(F)cc(C)c3c3cccc[n+]23)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C27H22F2N2/c1-17-12-20(28)14-19-15-25(31-11-7-5-9-24(31)26(17)19)22-16-21(29)13-18(2)27(22)23-8-4-6-10-30(23)3/h4-16H,1-3H3/q+2 |
| InChIKey | RHILUXQDUDGUPF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 7.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|