About 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline
2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 123758348) has the molecular formula C14H10ClN5O
and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline.
Molecular Properties
| Compound Name | 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline |
| PubChem CID | 123758348 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | [H]/N=C(\c1ccnc(Cl)c1)c1cc(-c2nnco2)ccc1N |
| InChI | InChI=1S/C14H10ClN5O/c15-12-6-8(3-4-18-12)13(17)10-5-9(1-2-11(10)16)14-20-19-7-21-14/h1-7,17H,16H2/b17-13+ |
| InChIKey | XVWPWHHBFOOTAV-GHRIWEEISA-N |
| XLogP | 2.78 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline?
The IUPAC name of 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline (CID 123758348) is 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline.
What is the SMILES notation for 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline?
The canonical SMILES for 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline is [H]/N=C(\c1ccnc(Cl)c1)c1cc(-c2nnco2)ccc1N.
What is the InChIKey of 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline?
The InChIKey is XVWPWHHBFOOTAV-GHRIWEEISA-N. The full InChI is InChI=1S/C14H10ClN5O/c15-12-6-8(3-4-18-12)13(17)10-5-9(1-2-11(10)16)14-20-19-7-21-14/h1-7,17H,16H2/b17-13+.
What are the key properties of 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline?
2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline has a molecular weight of 299.72 g/mol, XLogP of 2.78, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloropyridine-4-carboximidoyl)-4-(1,3,4-oxadiazol-2-yl)aniline is sourced from PubChem (CID 123758348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).