About ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid
ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid (PubChem CID 123758457) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid |
| PubChem CID | 123758457 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid |
| SMILES | CC.CCOC.O=C(Cn1cccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H11NO3.C3H8O.C2H6/c15-12(10-5-2-1-3-6-10)9-14-8-4-7-11(14)13(16)17;1-3-4-2;1-2/h1-8H,9H2,(H,16,17);3H2,1-2H3;1-2H3 |
| InChIKey | SVRGCGFQIGWLTE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid?
The IUPAC name of ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid (CID 123758457) is ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid.
What is the SMILES notation for ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid?
The canonical SMILES for ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid is CC.CCOC.O=C(Cn1cccc1C(=O)O)c1ccccc1.
What is the InChIKey of ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid?
The InChIKey is SVRGCGFQIGWLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3.C3H8O.C2H6/c15-12(10-5-2-1-3-6-10)9-14-8-4-7-11(14)13(16)17;1-3-4-2;1-2/h1-8H,9H2,(H,16,17);3H2,1-2H3;1-2H3.
What are the key properties of ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid?
ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid has a molecular weight of 319.40 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxyethane;1-phenacylpyrrole-2-carboxylic acid is sourced from PubChem (CID 123758457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).