C15H22N2 — CID 123758833
N-[(6E,8Z)-2,4,6-trimethyl-8-propylidene-4,5-dihydroazonin-9-yl]methanimine (PubChem CID 123758833) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-[(6E,8Z)-2,4,6-trimethyl-8-propylidene-4,5-dihydroazonin-9-yl]methanimine.
| Compound Name | N-[(6E,8Z)-2,4,6-trimethyl-8-propylidene-4,5-dihydroazonin-9-yl]methanimine |
|---|---|
| PubChem CID | 123758833 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-[(6E,8Z)-2,4,6-trimethyl-8-propylidene-4,5-dihydroazonin-9-yl]methanimine |
| SMILES | C=N/C1=N/C(C)=CC(C)C/C(C)=C/C1=C/CC |
| InChI | InChI=1S/C15H22N2/c1-6-7-14-10-12(3)8-11(2)9-13(4)17-15(14)16-5/h7,9-11H,5-6,8H2,1-4H3/b12-10+,13-9?,14-7-,17-15+ |
| InChIKey | UMYSSVSPZFIDPH-GWYRIUFMSA-N |
| XLogP | 4.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|