About 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one
2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 123758890) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 123758890 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | CCc1[nH]nc2cc(C3CC34C(=O)Nc3ccc(OC)cc34)ccc12 |
| InChI | InChI=1S/C20H19N3O2/c1-3-16-13-6-4-11(8-18(13)23-22-16)15-10-20(15)14-9-12(25-2)5-7-17(14)21-19(20)24/h4-9,15H,3,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | RVJFLWMUHLIUAQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one (CID 123758890) is 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one is CCc1[nH]nc2cc(C3CC34C(=O)Nc3ccc(OC)cc34)ccc12.
What is the InChIKey of 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is RVJFLWMUHLIUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-3-16-13-6-4-11(8-18(13)23-22-16)15-10-20(15)14-9-12(25-2)5-7-17(14)21-19(20)24/h4-9,15H,3,10H2,1-2H3,(H,21,24)(H,22,23).
What are the key properties of 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one?
2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 333.39 g/mol, XLogP of 3.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(3-ethyl-2H-indazol-6-yl)-5-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 123758890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).