C20H15Cl3F3NO — CID 123758952
1-nitroso-6-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 123758952) has the molecular formula C20H15Cl3F3NO and a molecular weight of 448.70 g/mol. Its IUPAC name is 1-nitroso-6-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-nitroso-6-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 123758952 |
| Molecular Formula | C20H15Cl3F3NO |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 1-nitroso-6-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=NC1CCCc2cc(C=CC(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H15Cl3F3NO/c21-16-9-13(10-17(22)19(16)23)15(20(24,25)26)7-5-11-4-6-14-12(8-11)2-1-3-18(14)27-28/h4-10,15,18H,1-3H2 |
| InChIKey | WCLFKEWDHHKBPU-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|