C17H26F2N2O2 — CID 123759140
2-fluoro-N-[2-(2-fluorohex-2-enoylamino)cyclopentyl]hex-2-enamide (PubChem CID 123759140) has the molecular formula C17H26F2N2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-fluorohex-2-enoylamino)cyclopentyl]hex-2-enamide.
| Compound Name | 2-fluoro-N-[2-(2-fluorohex-2-enoylamino)cyclopentyl]hex-2-enamide |
|---|---|
| PubChem CID | 123759140 |
| Molecular Formula | C17H26F2N2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-fluoro-N-[2-(2-fluorohex-2-enoylamino)cyclopentyl]hex-2-enamide |
| SMILES | CCCC=C(F)C(=O)NC1CCCC1NC(=O)C(F)=CCCC |
| InChI | InChI=1S/C17H26F2N2O2/c1-3-5-8-12(18)16(22)20-14-10-7-11-15(14)21-17(23)13(19)9-6-4-2/h8-9,14-15H,3-7,10-11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | VXDXIECZPBYJOE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|