About 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine
2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine (PubChem CID 123759250) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine.
Molecular Properties
| Compound Name | 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine |
| PubChem CID | 123759250 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine |
| SMILES | CCC1CCC(/C2=N/C=C(OC)C=CCC2C)CC1 |
| InChI | InChI=1S/C17H27NO/c1-4-14-8-10-15(11-9-14)17-13(2)6-5-7-16(19-3)12-18-17/h5,7,12-15H,4,6,8-11H2,1-3H3/b7-5?,16-12?,18-17+ |
| InChIKey | MUEUBBPXDVEIOY-YRHOQOEESA-N |
| XLogP | 4.73 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine?
The IUPAC name of 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine (CID 123759250) is 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine.
What is the SMILES notation for 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine?
The canonical SMILES for 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine is CCC1CCC(/C2=N/C=C(OC)C=CCC2C)CC1.
What is the InChIKey of 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine?
The InChIKey is MUEUBBPXDVEIOY-YRHOQOEESA-N. The full InChI is InChI=1S/C17H27NO/c1-4-14-8-10-15(11-9-14)17-13(2)6-5-7-16(19-3)12-18-17/h5,7,12-15H,4,6,8-11H2,1-3H3/b7-5?,16-12?,18-17+.
What are the key properties of 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine?
2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine has a molecular weight of 261.41 g/mol, XLogP of 4.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylcyclohexyl)-7-methoxy-3-methyl-3,4-dihydroazocine is sourced from PubChem (CID 123759250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).