C13H16N3O4+ — CID 123759479
1-[2,3-dihydroxy-4-(5-methylidene-2-oxopyrazol-2-ium-1-yl)butyl]-5-methylidenepyrrol-2-one (PubChem CID 123759479) has the molecular formula C13H16N3O4+ and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-[2,3-dihydroxy-4-(5-methylidene-2-oxopyrazol-2-ium-1-yl)butyl]-5-methylidenepyrrol-2-one.
| Compound Name | 1-[2,3-dihydroxy-4-(5-methylidene-2-oxopyrazol-2-ium-1-yl)butyl]-5-methylidenepyrrol-2-one |
|---|---|
| PubChem CID | 123759479 |
| Molecular Formula | C13H16N3O4+ |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-[2,3-dihydroxy-4-(5-methylidene-2-oxopyrazol-2-ium-1-yl)butyl]-5-methylidenepyrrol-2-one |
| SMILES | C=C1C=CC(=O)N1CC(O)C(O)CN1C(=C)C=C[N+]1=O |
| InChI | InChI=1S/C13H16N3O4/c1-9-3-4-13(19)14(9)7-11(17)12(18)8-15-10(2)5-6-16(15)20/h3-6,11-12,17-18H,1-2,7-8H2/q+1 |
| InChIKey | KGUQEQKAZSWIFS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|