C25H22F2N6O3 — CID 123759565
6-[(1-amino-1-oxopropan-2-yl)amino]-2-[4-[3-cyano-4-(1,1-difluorobut-3-enyl)phenoxy]phenyl]pyrimidine-4-carboxamide (PubChem CID 123759565) has the molecular formula C25H22F2N6O3 and a molecular weight of 492.49 g/mol. Its IUPAC name is 6-[(1-amino-1-oxopropan-2-yl)amino]-2-[4-[3-cyano-4-(1,1-difluorobut-3-enyl)phenoxy]phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-[(1-amino-1-oxopropan-2-yl)amino]-2-[4-[3-cyano-4-(1,1-difluorobut-3-enyl)phenoxy]phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123759565 |
| Molecular Formula | C25H22F2N6O3 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 6-[(1-amino-1-oxopropan-2-yl)amino]-2-[4-[3-cyano-4-(1,1-difluorobut-3-enyl)phenoxy]phenyl]pyrimidine-4-carboxamide |
| SMILES | C=CCC(F)(F)c1ccc(Oc2ccc(-c3nc(NC(C)C(N)=O)cc(C(N)=O)n3)cc2)cc1C#N |
| InChI | InChI=1S/C25H22F2N6O3/c1-3-10-25(26,27)19-9-8-18(11-16(19)13-28)36-17-6-4-15(5-7-17)24-32-20(23(30)35)12-21(33-24)31-14(2)22(29)34/h3-9,11-12,14H,1,10H2,2H3,(H2,29,34)(H2,30,35)(H,31,32,33) |
| InChIKey | VDPFRJQLRLHTSJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 157.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|