C23H27N5O2 — CID 123759933
8-(2-amino-4-methylpentoxy)-4,6-dimethyl-9-pyrazol-1-ylbenzo[c][2,7]naphthyridin-5-one (PubChem CID 123759933) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 8-(2-amino-4-methylpentoxy)-4,6-dimethyl-9-pyrazol-1-ylbenzo[c][2,7]naphthyridin-5-one.
| Compound Name | 8-(2-amino-4-methylpentoxy)-4,6-dimethyl-9-pyrazol-1-ylbenzo[c][2,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 123759933 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 8-(2-amino-4-methylpentoxy)-4,6-dimethyl-9-pyrazol-1-ylbenzo[c][2,7]naphthyridin-5-one |
| SMILES | Cc1nccc2c1c(=O)n(C)c1cc(OCC(N)CC(C)C)c(-n3cccn3)cc21 |
| InChI | InChI=1S/C23H27N5O2/c1-14(2)10-16(24)13-30-21-12-19-18(11-20(21)28-9-5-7-26-28)17-6-8-25-15(3)22(17)23(29)27(19)4/h5-9,11-12,14,16H,10,13,24H2,1-4H3 |
| InChIKey | IMXJOLDEQNAXKK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|