C11H16F2N4O3 — CID 123760316
4,4-difluoro-N-(1-methylazetidin-3-yl)oxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 123760316) has the molecular formula C11H16F2N4O3 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4,4-difluoro-N-(1-methylazetidin-3-yl)oxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | 4,4-difluoro-N-(1-methylazetidin-3-yl)oxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 123760316 |
| Molecular Formula | C11H16F2N4O3 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4,4-difluoro-N-(1-methylazetidin-3-yl)oxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | CN1CC(ONC(=O)C2CC(F)(F)C3CN2C(=O)N3)C1 |
| InChI | InChI=1S/C11H16F2N4O3/c1-16-3-6(4-16)20-15-9(18)7-2-11(12,13)8-5-17(7)10(19)14-8/h6-8H,2-5H2,1H3,(H,14,19)(H,15,18) |
| InChIKey | PJUOYBOTSAXHNT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|