C13H28B2O4 — CID 123760802
ethoxy-(2-methylbutan-2-yloxy)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane (PubChem CID 123760802) has the molecular formula C13H28B2O4 and a molecular weight of 269.99 g/mol. Its IUPAC name is ethoxy-(2-methylbutan-2-yloxy)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane.
| Compound Name | ethoxy-(2-methylbutan-2-yloxy)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane |
|---|---|
| PubChem CID | 123760802 |
| Molecular Formula | C13H28B2O4 |
| Molecular Weight | 269.99 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | ethoxy-(2-methylbutan-2-yloxy)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane |
| SMILES | CCOB(OC(C)(C)CC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H28B2O4/c1-9-11(3,4)17-14(16-10-2)15-18-12(5,6)13(7,8)19-15/h9-10H2,1-8H3 |
| InChIKey | RDFUKHLDQFKKKA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.99 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|