C33H38F2N2O4 — CID 123760885
2-[[4-[2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]cycloheptyl]methyl]-8-(difluoromethoxy)-N-(2-methoxyethyl)isoquinoline-7-carboxamide (PubChem CID 123760885) has the molecular formula C33H38F2N2O4 and a molecular weight of 564.67 g/mol. Its IUPAC name is 2-[[4-[2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]cycloheptyl]methyl]-8-(difluoromethoxy)-N-(2-methoxyethyl)isoquinoline-7-carboxamide.
| Compound Name | 2-[[4-[2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]cycloheptyl]methyl]-8-(difluoromethoxy)-N-(2-methoxyethyl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123760885 |
| Molecular Formula | C33H38F2N2O4 |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-[[4-[2-(4-cyclopropylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]cycloheptyl]methyl]-8-(difluoromethoxy)-N-(2-methoxyethyl)isoquinoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1OC(F)F)=CN(CC1CCCC(=CC(=O)C3=CC=C(C4CC4)CC3)CC1)C=C=2 |
| InChI | InChI=1S/C33H38F2N2O4/c1-40-18-16-36-32(39)28-14-13-26-15-17-37(21-29(26)31(28)41-33(34)35)20-23-4-2-3-22(5-6-23)19-30(38)27-11-9-25(10-12-27)24-7-8-24/h9,11,13-14,17,19,21,23-24,33H,2-8,10,12,16,18,20H2,1H3,(H,36,39) |
| InChIKey | ITIYFGMZTZYALD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|