C20H29FN2O — CID 123761118
16-fluoro-6-imino-10,13-dimethyl-3-methylimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 123761118) has the molecular formula C20H29FN2O and a molecular weight of 332.46 g/mol. Its IUPAC name is 16-fluoro-6-imino-10,13-dimethyl-3-methylimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 16-fluoro-6-imino-10,13-dimethyl-3-methylimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123761118 |
| Molecular Formula | C20H29FN2O |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 16-fluoro-6-imino-10,13-dimethyl-3-methylimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | [H]/N=C1\CC2C3CC(F)C(=O)C3(C)CCC2C2(C)CC/C(=N\C)CC12 |
| InChI | InChI=1S/C20H29FN2O/c1-19-6-4-11(23-3)8-15(19)17(22)9-12-13(19)5-7-20(2)14(12)10-16(21)18(20)24/h12-16,22H,4-10H2,1-3H3/b22-17+,23-11+ |
| InChIKey | LTKDKIDNUORXQI-OTPWYYPSSA-N |
| XLogP | 4.25 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|