C14H21F3N2 — CID 123762068
1-[2-ethenyl-3-(trifluoromethyl)penta-2,4-dienyl]-4-ethylpiperazine (PubChem CID 123762068) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-[2-ethenyl-3-(trifluoromethyl)penta-2,4-dienyl]-4-ethylpiperazine.
| Compound Name | 1-[2-ethenyl-3-(trifluoromethyl)penta-2,4-dienyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 123762068 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[2-ethenyl-3-(trifluoromethyl)penta-2,4-dienyl]-4-ethylpiperazine |
| SMILES | C=CC(CN1CCN(CC)CC1)=C(C=C)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2/c1-4-12(13(5-2)14(15,16)17)11-19-9-7-18(6-3)8-10-19/h4-5H,1-2,6-11H2,3H3 |
| InChIKey | OOKLJLIJYCWNFH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|