About 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide
2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide (PubChem CID 123762168) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide |
| PubChem CID | 123762168 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide |
| SMILES | CC(=O)C(=O)NC(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9(14)10(15)13-12(5,6)8-7-11(2,3)4/h7-8H2,1-6H3,(H,13,15) |
| InChIKey | SWNLBBUCXDFDCQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide?
The IUPAC name of 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide (CID 123762168) is 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide.
What is the SMILES notation for 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide?
The canonical SMILES for 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide is CC(=O)C(=O)NC(C)(C)CCC(C)(C)C.
What is the InChIKey of 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide?
The InChIKey is SWNLBBUCXDFDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-9(14)10(15)13-12(5,6)8-7-11(2,3)4/h7-8H2,1-6H3,(H,13,15).
What are the key properties of 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide?
2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide has a molecular weight of 213.32 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-(2,5,5-trimethylhexan-2-yl)propanamide is sourced from PubChem (CID 123762168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).