C24H21F3O5 — CID 123762256
(1R,2S,6R,7S)-4-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123762256) has the molecular formula C24H21F3O5 and a molecular weight of 446.42 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123762256 |
| Molecular Formula | C24H21F3O5 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (1R,2S,6R,7S)-4-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C24H21F3O5/c1-2-12-3-4-15(30-13-5-7-14(8-6-13)32-24(25,26)27)11-16(12)19-22(28)20-17-9-10-18(31-17)21(20)23(19)29/h3-8,11,17-21H,2,9-10H2,1H3/t17-,18+,19?,20-,21+ |
| InChIKey | CEMHYQQJLVBWDV-YTDWZJOKSA-N |
| XLogP | 4.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|