About tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane
tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane (PubChem CID 123762287) has the molecular formula C16H34O4Si
and a molecular weight of 318.53 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane.
Molecular Properties
| Compound Name | tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane |
| PubChem CID | 123762287 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)OCOC.CC[C@H]1CO1 |
| InChI | InChI=1S/C12H26O3Si.C4H8O/c1-8-11(14-10-13-5)9-15-16(6,7)12(2,3)4;1-2-4-3-5-4/h8,11H,1,9-10H2,2-7H3;4H,2-3H2,1H3/t11-;4-/m10/s1 |
| InChIKey | BWAVBNHGKZNWFZ-PPXKCNQSSA-N |
| XLogP | 3.98 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane?
The IUPAC name of tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane (CID 123762287) is tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane.
What is the SMILES notation for tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane?
The canonical SMILES for tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane is C=C[C@H](CO[Si](C)(C)C(C)(C)C)OCOC.CC[C@H]1CO1.
What is the InChIKey of tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane?
The InChIKey is BWAVBNHGKZNWFZ-PPXKCNQSSA-N. The full InChI is InChI=1S/C12H26O3Si.C4H8O/c1-8-11(14-10-13-5)9-15-16(6,7)12(2,3)4;1-2-4-3-5-4/h8,11H,1,9-10H2,2-7H3;4H,2-3H2,1H3/t11-;4-/m10/s1.
What are the key properties of tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane?
tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane has a molecular weight of 318.53 g/mol, XLogP of 3.98, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2R)-2-(methoxymethoxy)but-3-enoxy]-dimethylsilane;(2S)-2-ethyloxirane is sourced from PubChem (CID 123762287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).